C8H16N2O2S2 — CID 522321
2-sulfanyl-N-[2-(2-sulfanylpropanoylamino)ethyl]propanamide (PubChem CID 522321) has the molecular formula C8H16N2O2S2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-sulfanyl-N-[2-(2-sulfanylpropanoylamino)ethyl]propanamide.
| Compound Name | 2-sulfanyl-N-[2-(2-sulfanylpropanoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 522321 |
| Molecular Formula | C8H16N2O2S2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-sulfanyl-N-[2-(2-sulfanylpropanoylamino)ethyl]propanamide |
| SMILES | CC(S)C(=O)NCCNC(=O)C(C)S |
| InChI | InChI=1S/C8H16N2O2S2/c1-5(13)7(11)9-3-4-10-8(12)6(2)14/h5-6,13-14H,3-4H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | NQBOCGBWMCQBAA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|