About Ethylene bis mercaptoacetamide
Ethylene bis mercaptoacetamide (PubChem CID 368250) has the molecular formula C6H12N2O2S2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-sulfanyl-N-[2-[(2-sulfanylacetyl)amino]ethyl]acetamide.
Molecular Properties
| Compound Name | Ethylene bis mercaptoacetamide |
| PubChem CID | 368250 |
| Molecular Formula | C6H12N2O2S2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 2-sulfanyl-N-[2-[(2-sulfanylacetyl)amino]ethyl]acetamide |
| SMILES | C(CNC(=O)CS)NC(=O)CS |
| InChI | InChI=1S/C6H12N2O2S2/c9-5(3-11)7-1-2-8-6(10)4-12/h11-12H,1-4H2,(H,7,9)(H,8,10) |
| InChIKey | SQPIKOWZWIINCK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | 146 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze Ethylene bis mercaptoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethylene bis mercaptoacetamide?
The IUPAC name of Ethylene bis mercaptoacetamide (CID 368250) is 2-sulfanyl-N-[2-[(2-sulfanylacetyl)amino]ethyl]acetamide.
What is the SMILES notation for Ethylene bis mercaptoacetamide?
The canonical SMILES for Ethylene bis mercaptoacetamide is C(CNC(=O)CS)NC(=O)CS.
What is the InChIKey of Ethylene bis mercaptoacetamide?
The InChIKey is SQPIKOWZWIINCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2S2/c9-5(3-11)7-1-2-8-6(10)4-12/h11-12H,1-4H2,(H,7,9)(H,8,10).
What are the key properties of Ethylene bis mercaptoacetamide?
Ethylene bis mercaptoacetamide has a molecular weight of 208.30 g/mol, XLogP of -0.50, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Ethylene bis mercaptoacetamide is sourced from PubChem (CID 368250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).