C8H15N3O2S — CID 19438557
1-thia-4,7,10-triazacyclododecane-3,11-dione (PubChem CID 19438557) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 1-thia-4,7,10-triazacyclododecane-3,11-dione.
| Compound Name | 1-thia-4,7,10-triazacyclododecane-3,11-dione |
|---|---|
| PubChem CID | 19438557 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-thia-4,7,10-triazacyclododecane-3,11-dione |
| SMILES | O=C1CSCC(=O)NCCNCCN1 |
| InChI | InChI=1S/C8H15N3O2S/c12-7-5-14-6-8(13)11-4-2-9-1-3-10-7/h9H,1-6H2,(H,10,12)(H,11,13) |
| InChIKey | NURQMHZFVOWVHU-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |