C12H24N4O2S2 — CID 45272165
2-sulfanyl-1-[7-(2-sulfanylacetyl)-1,4,7,10-tetrazacyclododec-1-yl]ethanone (PubChem CID 45272165) has the molecular formula C12H24N4O2S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 2-sulfanyl-1-[7-(2-sulfanylacetyl)-1,4,7,10-tetrazacyclododec-1-yl]ethanone.
| Compound Name | 2-sulfanyl-1-[7-(2-sulfanylacetyl)-1,4,7,10-tetrazacyclododec-1-yl]ethanone |
|---|---|
| PubChem CID | 45272165 |
| Molecular Formula | C12H24N4O2S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-sulfanyl-1-[7-(2-sulfanylacetyl)-1,4,7,10-tetrazacyclododec-1-yl]ethanone |
| SMILES | O=C(CS)N1CCNCCN(C(=O)CS)CCNCC1 |
| InChI | InChI=1S/C12H24N4O2S2/c17-11(9-19)15-5-1-13-2-6-16(12(18)10-20)8-4-14-3-7-15/h13-14,19-20H,1-10H2 |
| InChIKey | MQXJSRFLOBWSAM-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|