C10H22N4O2S2 — CID 10424549
2-(methylamino)-N-[2-[2-[[2-(methylamino)acetyl]amino]ethyldisulfanyl]ethyl]acetamide (PubChem CID 10424549) has the molecular formula C10H22N4O2S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 2-(methylamino)-N-[2-[2-[[2-(methylamino)acetyl]amino]ethyldisulfanyl]ethyl]acetamide.
| Compound Name | 2-(methylamino)-N-[2-[2-[[2-(methylamino)acetyl]amino]ethyldisulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 10424549 |
| Molecular Formula | C10H22N4O2S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(methylamino)-N-[2-[2-[[2-(methylamino)acetyl]amino]ethyldisulfanyl]ethyl]acetamide |
| SMILES | CNCC(=O)NCCSSCCNC(=O)CNC |
| InChI | InChI=1S/C10H22N4O2S2/c1-11-7-9(15)13-3-5-17-18-6-4-14-10(16)8-12-2/h11-12H,3-8H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | CPUCKTMPDMVQHL-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|