3,5-dichlorobenzenesulfonyl chloride

C6H3Cl3O2S — CID 522388

IUPAC3,5-dichlorobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C6H3Cl3O2S/c7-4-1-5(8)3-6(2-4)12(9,10)11/h1-3H
InChIKeyRJSQINMKOSOUGT-UHFFFAOYSA-N
MW245.51 g/mol
LogP2.92
Rot. Bonds1

About 3,5-dichlorobenzenesulfonyl chloride

3,5-dichlorobenzenesulfonyl chloride (PubChem CID 522388) has the molecular formula C6H3Cl3O2S and a molecular weight of 245.51 g/mol. Its IUPAC name is 3,5-dichlorobenzenesulfonyl chloride.

Molecular Properties

Compound Name3,5-dichlorobenzenesulfonyl chloride
PubChem CID522388
Molecular FormulaC6H3Cl3O2S
Molecular Weight245.51 g/mol
Exact Mass243.89
IUPAC Name3,5-dichlorobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C6H3Cl3O2S/c7-4-1-5(8)3-6(2-4)12(9,10)11/h1-3H
InChIKeyRJSQINMKOSOUGT-UHFFFAOYSA-N
XLogP2.92
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.51
LogP ≤ 52.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 3,5-dichlorobenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dichlorobenzenesulfonyl chloride?
The IUPAC name of 3,5-dichlorobenzenesulfonyl chloride (CID 522388) is 3,5-dichlorobenzenesulfonyl chloride.
What is the SMILES notation for 3,5-dichlorobenzenesulfonyl chloride?
The canonical SMILES for 3,5-dichlorobenzenesulfonyl chloride is O=S(=O)(Cl)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 3,5-dichlorobenzenesulfonyl chloride?
The InChIKey is RJSQINMKOSOUGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl3O2S/c7-4-1-5(8)3-6(2-4)12(9,10)11/h1-3H.
What are the key properties of 3,5-dichlorobenzenesulfonyl chloride?
3,5-dichlorobenzenesulfonyl chloride has a molecular weight of 245.51 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichlorobenzenesulfonyl chloride is sourced from PubChem (CID 522388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).