C7H12O4 — CID 522784
methyl 2,3-dimethoxybut-3-enoate (PubChem CID 522784) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is methyl 2,3-dimethoxybut-3-enoate.
| Compound Name | methyl 2,3-dimethoxybut-3-enoate |
|---|---|
| PubChem CID | 522784 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | methyl 2,3-dimethoxybut-3-enoate |
| SMILES | C=C(OC)C(OC)C(=O)OC |
| InChI | InChI=1S/C7H12O4/c1-5(9-2)6(10-3)7(8)11-4/h6H,1H2,2-4H3 |
| InChIKey | JHQCIXLLYZYJQW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|