C8H12O4 — CID 150170529
3,4-diethoxy-3H-furan-2-one (PubChem CID 150170529) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3,4-diethoxy-3H-furan-2-one.
| Compound Name | 3,4-diethoxy-3H-furan-2-one |
|---|---|
| PubChem CID | 150170529 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3,4-diethoxy-3H-furan-2-one |
| SMILES | CCOC1=COC(=O)C1OCC |
| InChI | InChI=1S/C8H12O4/c1-3-10-6-5-12-8(9)7(6)11-4-2/h5,7H,3-4H2,1-2H3 |
| InChIKey | FJINQAXFAJJPAS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |