C9H13LiO6 — CID 155932139
lithium (E)-methoxy-[(5R)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-ylidene]methanolate (PubChem CID 155932139) has the molecular formula C9H13LiO6 and a molecular weight of 224.14 g/mol. Its IUPAC name is lithium (E)-methoxy-[(5R)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-ylidene]methanolate.
| Compound Name | lithium (E)-methoxy-[(5R)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-ylidene]methanolate |
|---|---|
| PubChem CID | 155932139 |
| Molecular Formula | C9H13LiO6 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | lithium (E)-methoxy-[(5R)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-ylidene]methanolate |
| SMILES | COC(=O)[C@@H]1OC(C)(C)O/C1=C(\[O-])OC.[Li+] |
| InChI | InChI=1S/C9H14O6.Li/c1-9(2)14-5(7(10)12-3)6(15-9)8(11)13-4;/h5,11H,1-4H3;/q;+1/p-1/b8-6+;/t5-;/m1./s1 |
| InChIKey | ODTVYOYMKODMFD-DUOSGGMISA-M |
| XLogP | -3.51 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|