C7H8O5 — CID 141159888
2,2-dimethyl-5-(oxomethylidene)-1,3-dioxolane-4-carboxylic acid (PubChem CID 141159888) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is 2,2-dimethyl-5-(oxomethylidene)-1,3-dioxolane-4-carboxylic acid.
| Compound Name | 2,2-dimethyl-5-(oxomethylidene)-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 141159888 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 2,2-dimethyl-5-(oxomethylidene)-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)OC(=C=O)C(C(=O)O)O1 |
| InChI | InChI=1S/C7H8O5/c1-7(2)11-4(3-8)5(12-7)6(9)10/h5H,1-2H3,(H,9,10) |
| InChIKey | BLCGRWYKIWBGEG-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|