C12H22O6Si — CID 10493728
methyl (4S,5E)-5-[methoxy(trimethylsilyloxy)methylidene]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 10493728) has the molecular formula C12H22O6Si and a molecular weight of 290.39 g/mol. Its IUPAC name is methyl (4S,5E)-5-[methoxy(trimethylsilyloxy)methylidene]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4S,5E)-5-[methoxy(trimethylsilyloxy)methylidene]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 10493728 |
| Molecular Formula | C12H22O6Si |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | methyl (4S,5E)-5-[methoxy(trimethylsilyloxy)methylidene]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@H]1OC(C)(C)O/C1=C(\OC)O[Si](C)(C)C |
| InChI | InChI=1S/C12H22O6Si/c1-12(2)16-8(10(13)14-3)9(17-12)11(15-4)18-19(5,6)7/h8H,1-7H3/b11-9+/t8-/m0/s1 |
| InChIKey | PITUUBJIDQFSFY-QMIUEANQSA-N |
| XLogP | 1.98 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|