C18H34O6Si — CID 100957769
tert-butyl (4S,5Z)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxy-trimethylsilyloxymethylidene]-1,3-dioxolane-4-carboxylate (PubChem CID 100957769) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is tert-butyl (4S,5Z)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxy-trimethylsilyloxymethylidene]-1,3-dioxolane-4-carboxylate.
| Compound Name | tert-butyl (4S,5Z)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxy-trimethylsilyloxymethylidene]-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 100957769 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | tert-butyl (4S,5Z)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxy-trimethylsilyloxymethylidene]-1,3-dioxolane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1OC(C)(C)O/C1=C(/OC(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H34O6Si/c1-16(2,3)22-14(19)12-13(21-18(7,8)20-12)15(23-17(4,5)6)24-25(9,10)11/h12H,1-11H3/b15-13-/t12-/m0/s1 |
| InChIKey | FZEZKFUOSXKRIZ-AHAXBBEGSA-N |
| XLogP | 4.32 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|