C14H24O6Si — CID 10495645
methyl (2S,3E)-3-[methoxy(trimethylsilyloxy)methylidene]-1,4-dioxaspiro[4.4]nonane-2-carboxylate (PubChem CID 10495645) has the molecular formula C14H24O6Si and a molecular weight of 316.43 g/mol. Its IUPAC name is methyl (2S,3E)-3-[methoxy(trimethylsilyloxy)methylidene]-1,4-dioxaspiro[4.4]nonane-2-carboxylate.
| Compound Name | methyl (2S,3E)-3-[methoxy(trimethylsilyloxy)methylidene]-1,4-dioxaspiro[4.4]nonane-2-carboxylate |
|---|---|
| PubChem CID | 10495645 |
| Molecular Formula | C14H24O6Si |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | methyl (2S,3E)-3-[methoxy(trimethylsilyloxy)methylidene]-1,4-dioxaspiro[4.4]nonane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC2(CCCC2)O/C1=C(\OC)O[Si](C)(C)C |
| InChI | InChI=1S/C14H24O6Si/c1-16-12(15)10-11(13(17-2)20-21(3,4)5)19-14(18-10)8-6-7-9-14/h10H,6-9H2,1-5H3/b13-11+/t10-/m0/s1 |
| InChIKey | QTTRJMULTWSJNE-GYXQTMOZSA-N |
| XLogP | 2.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|