C20H36O6Si — CID 11729085
tert-butyl (2R,3Z)-3-[(2-methylpropan-2-yl)oxy-trimethylsilyloxymethylidene]-1,4-dioxaspiro[4.4]nonane-2-carboxylate (PubChem CID 11729085) has the molecular formula C20H36O6Si and a molecular weight of 400.59 g/mol. Its IUPAC name is tert-butyl (2R,3Z)-3-[(2-methylpropan-2-yl)oxy-trimethylsilyloxymethylidene]-1,4-dioxaspiro[4.4]nonane-2-carboxylate.
| Compound Name | tert-butyl (2R,3Z)-3-[(2-methylpropan-2-yl)oxy-trimethylsilyloxymethylidene]-1,4-dioxaspiro[4.4]nonane-2-carboxylate |
|---|---|
| PubChem CID | 11729085 |
| Molecular Formula | C20H36O6Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | tert-butyl (2R,3Z)-3-[(2-methylpropan-2-yl)oxy-trimethylsilyloxymethylidene]-1,4-dioxaspiro[4.4]nonane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1OC2(CCCC2)O/C1=C(/OC(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H36O6Si/c1-18(2,3)24-16(21)14-15(23-20(22-14)12-10-11-13-20)17(25-19(4,5)6)26-27(7,8)9/h14H,10-13H2,1-9H3/b17-15-/t14-/m1/s1 |
| InChIKey | GJUGHFQLGAFBSH-XEVXXXDWSA-N |
| XLogP | 4.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|