C28H21ClN2O6S — CID 5229438
methyl 4-[1-(6-chloro-1,3-benzothiazol-2-yl)-3-[(3-ethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 5229438) has the molecular formula C28H21ClN2O6S and a molecular weight of 549.00 g/mol. Its IUPAC name is methyl 4-[1-(6-chloro-1,3-benzothiazol-2-yl)-3-[(3-ethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[1-(6-chloro-1,3-benzothiazol-2-yl)-3-[(3-ethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 5229438 |
| Molecular Formula | C28H21ClN2O6S |
| Molecular Weight | 549.00 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | methyl 4-[1-(6-chloro-1,3-benzothiazol-2-yl)-3-[(3-ethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | CCOc1cccc(C(O)=C2C(=O)C(=O)N(c3nc4ccc(Cl)cc4s3)C2c2ccc(C(=O)OC)cc2)c1 |
| InChI | InChI=1S/C28H21ClN2O6S/c1-3-37-19-6-4-5-17(13-19)24(32)22-23(15-7-9-16(10-8-15)27(35)36-2)31(26(34)25(22)33)28-30-20-12-11-18(29)14-21(20)38-28/h4-14,23,32H,3H2,1-2H3 |
| InChIKey | PSRUUFZFDFGJPQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.00 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|