C29H23ClN2O5S — CID 6307791
(4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6307791) has the molecular formula C29H23ClN2O5S and a molecular weight of 547.03 g/mol. Its IUPAC name is (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6307791 |
| Molecular Formula | C29H23ClN2O5S |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C2/C(=C(\O)c3cccc(OCC)c3)C(=O)C(=O)N2c2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C29H23ClN2O5S/c1-3-14-37-20-11-8-17(9-12-20)25-24(26(33)18-6-5-7-21(15-18)36-4-2)27(34)28(35)32(25)29-31-22-13-10-19(30)16-23(22)38-29/h3,5-13,15-16,25,33H,1,4,14H2,2H3/b26-24+ |
| InChIKey | UKKYRBFZVZRFNO-SHHOIMCASA-N |
| XLogP | 6.54 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|