About [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate
[4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate (PubChem CID 5230003) has the molecular formula C21H16IN3O3
and a molecular weight of 485.28 g/mol. Its IUPAC name is [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate.
Molecular Properties
| Compound Name | [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate |
| PubChem CID | 5230003 |
| Molecular Formula | C21H16IN3O3 |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate |
| SMILES | Cc1ccccc1C(=O)/N=N/c1ccc(NOC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C21H16IN3O3/c1-14-6-2-3-7-17(14)20(26)24-23-15-10-12-16(13-11-15)25-28-21(27)18-8-4-5-9-19(18)22/h2-13,25H,1H3/b24-23+ |
| InChIKey | AEOJDFVNMOWALZ-WCWDXBQESA-N |
| XLogP | 5.71 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate?
The IUPAC name of [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate (CID 5230003) is [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate.
What is the SMILES notation for [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate?
The canonical SMILES for [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate is Cc1ccccc1C(=O)/N=N/c1ccc(NOC(=O)c2ccccc2I)cc1.
What is the InChIKey of [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate?
The InChIKey is AEOJDFVNMOWALZ-WCWDXBQESA-N. The full InChI is InChI=1S/C21H16IN3O3/c1-14-6-2-3-7-17(14)20(26)24-23-15-10-12-16(13-11-15)25-28-21(27)18-8-4-5-9-19(18)22/h2-13,25H,1H3/b24-23+.
What are the key properties of [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate?
[4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate has a molecular weight of 485.28 g/mol, XLogP of 5.71, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-methylbenzoyl)diazenyl]anilino] 2-iodobenzoate is sourced from PubChem (CID 5230003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).