C11H9FN2O3 — CID 52312484
2-[(4-fluorophenyl)methyl]-3-oxo-1H-pyrazole-4-carboxylic acid (PubChem CID 52312484) has the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-oxo-1H-pyrazole-4-carboxylic acid.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-oxo-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 52312484 |
| Molecular Formula | C11H9FN2O3 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-oxo-1H-pyrazole-4-carboxylic acid |
| SMILES | C1=CC(=CC=C1CN2C(=O)C(=CN2)C(=O)O)F |
| InChI | InChI=1S/C11H9FN2O3/c12-8-3-1-7(2-4-8)6-14-10(15)9(5-13-14)11(16)17/h1-5,13H,6H2,(H,16,17) |
| InChIKey | LJJKZGMSJYRQOA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | 362 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |