C7H9NO — CID 5231768
1-(1,2-dihydropyridin-4-yl)ethanone (PubChem CID 5231768) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 1-(1,2-dihydropyridin-4-yl)ethanone.
| Compound Name | 1-(1,2-dihydropyridin-4-yl)ethanone |
|---|---|
| PubChem CID | 5231768 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 1-(1,2-dihydropyridin-4-yl)ethanone |
| SMILES | CC(=O)C1=CCNC=C1 |
| InChI | InChI=1S/C7H9NO/c1-6(9)7-2-4-8-5-3-7/h2-4,8H,5H2,1H3 |
| InChIKey | XNJSTNYJIJXZRL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |