C25H23N3O — CID 5231845
4-(4-butoxyphenyl)-2,6-dipyridin-4-ylpyridine (PubChem CID 5231845) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-2,6-dipyridin-4-ylpyridine.
| Compound Name | 4-(4-butoxyphenyl)-2,6-dipyridin-4-ylpyridine |
|---|---|
| PubChem CID | 5231845 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-(4-butoxyphenyl)-2,6-dipyridin-4-ylpyridine |
| SMILES | CCCCOc1ccc(-c2cc(-c3ccncc3)nc(-c3ccncc3)c2)cc1 |
| InChI | InChI=1S/C25H23N3O/c1-2-3-16-29-23-6-4-19(5-7-23)22-17-24(20-8-12-26-13-9-20)28-25(18-22)21-10-14-27-15-11-21/h4-15,17-18H,2-3,16H2,1H3 |
| InChIKey | HKHGOKCRLWNIPT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|