C31H32Cl2N2O3SnV — CID 5232081
dichloro(diphenyl)stannane;2-[N-[2-[1-(2-hydroxyphenyl)ethylideneamino]propyl]-C-methylcarbonimidoyl]phenol;oxovanadium (PubChem CID 5232081) has the molecular formula C31H32Cl2N2O3SnV and a molecular weight of 721.17 g/mol. Its IUPAC name is dichloro(diphenyl)stannane;2-[N-[2-[1-(2-hydroxyphenyl)ethylideneamino]propyl]-C-methylcarbonimidoyl]phenol;oxovanadium.
| Compound Name | dichloro(diphenyl)stannane;2-[N-[2-[1-(2-hydroxyphenyl)ethylideneamino]propyl]-C-methylcarbonimidoyl]phenol;oxovanadium |
|---|---|
| PubChem CID | 5232081 |
| Molecular Formula | C31H32Cl2N2O3SnV |
| Molecular Weight | 721.17 g/mol |
| Exact Mass | 721.03 |
| IUPAC Name | dichloro(diphenyl)stannane;2-[N-[2-[1-(2-hydroxyphenyl)ethylideneamino]propyl]-C-methylcarbonimidoyl]phenol;oxovanadium |
| SMILES | C/C(=N\CC(C)/N=C(\C)c1ccccc1O)c1ccccc1O.Cl[Sn](Cl)(c1ccccc1)c1ccccc1.O=[V] |
| InChI | InChI=1S/C19H22N2O2.2C6H5.2ClH.O.Sn.V/c1-13(21-15(3)17-9-5-7-11-19(17)23)12-20-14(2)16-8-4-6-10-18(16)22;2*1-2-4-6-5-3-1;;;;;/h4-11,13,22-23H,12H2,1-3H3;2*1-5H;2*1H;;;/q;;;;;;+2;/p-2/b20-14+,21-15+;;;;;;; |
| InChIKey | YCEIHPGLIGPQDQ-ZEKKBAPQSA-L |
| XLogP | 6.40 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.17 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|