C16H25NO8 — CID 5232230
tetramethyl 2-piperidin-4-ylpropane-1,1,3,3-tetracarboxylate (PubChem CID 5232230) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is tetramethyl 2-piperidin-4-ylpropane-1,1,3,3-tetracarboxylate.
| Compound Name | tetramethyl 2-piperidin-4-ylpropane-1,1,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 5232230 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | tetramethyl 2-piperidin-4-ylpropane-1,1,3,3-tetracarboxylate |
| SMILES | COC(=O)C(C(=O)OC)C(C1CCNCC1)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H25NO8/c1-22-13(18)11(14(19)23-2)10(9-5-7-17-8-6-9)12(15(20)24-3)16(21)25-4/h9-12,17H,5-8H2,1-4H3 |
| InChIKey | QBISSKVDOWFTRV-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|