C9H13N3O5S — CID 5233001
N-(3-amino-2-hydroxypropyl)-4-nitrobenzenesulfonamide (PubChem CID 5233001) has the molecular formula C9H13N3O5S and a molecular weight of 275.29 g/mol. Its IUPAC name is N-(3-amino-2-hydroxypropyl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(3-amino-2-hydroxypropyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 5233001 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-(3-amino-2-hydroxypropyl)-4-nitrobenzenesulfonamide |
| SMILES | NCC(O)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H13N3O5S/c10-5-8(13)6-11-18(16,17)9-3-1-7(2-4-9)12(14)15/h1-4,8,11,13H,5-6,10H2 |
| InChIKey | AXNOEQAVYCPIIU-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|