C14H8F2NO4S- — CID 5233214
4-[(2,5-difluorophenyl)methylsulfanyl]-3-nitrobenzoate (PubChem CID 5233214) has the molecular formula C14H8F2NO4S- and a molecular weight of 324.28 g/mol. Its IUPAC name is 4-[(2,5-difluorophenyl)methylsulfanyl]-3-nitrobenzoate.
| Compound Name | 4-[(2,5-difluorophenyl)methylsulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 5233214 |
| Molecular Formula | C14H8F2NO4S- |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-[(2,5-difluorophenyl)methylsulfanyl]-3-nitrobenzoate |
| SMILES | O=C([O-])c1ccc(SCc2cc(F)ccc2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9F2NO4S/c15-10-2-3-11(16)9(5-10)7-22-13-4-1-8(14(18)19)6-12(13)17(20)21/h1-6H,7H2,(H,18,19)/p-1 |
| InChIKey | YNXMARWNLWMPQJ-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|