C15H23NOS — CID 5234584
2-(1-adamantyl)-2-ethyl-1,3-thiazolidin-4-one (PubChem CID 5234584) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is 2-(1-adamantyl)-2-ethyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(1-adamantyl)-2-ethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5234584 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-(1-adamantyl)-2-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCC1(C23CC4CC(CC(C4)C2)C3)NC(=O)CS1 |
| InChI | InChI=1S/C15H23NOS/c1-2-15(16-13(17)9-18-15)14-6-10-3-11(7-14)5-12(4-10)8-14/h10-12H,2-9H2,1H3,(H,16,17) |
| InChIKey | PPHRSZCIJIHCSB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |