C28H33N5O4 — CID 5234841
tert-butyl 6-amino-5,7,7-tricyano-8-(3-ethoxy-4-propan-2-yloxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 5234841) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is tert-butyl 6-amino-5,7,7-tricyano-8-(3-ethoxy-4-propan-2-yloxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | tert-butyl 6-amino-5,7,7-tricyano-8-(3-ethoxy-4-propan-2-yloxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 5234841 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | tert-butyl 6-amino-5,7,7-tricyano-8-(3-ethoxy-4-propan-2-yloxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | CCOc1cc(C2C3CN(C(=O)OC(C)(C)C)CC=C3C(C#N)=C(N)C2(C#N)C#N)ccc1OC(C)C |
| InChI | InChI=1S/C28H33N5O4/c1-7-35-23-12-18(8-9-22(23)36-17(2)3)24-21-14-33(26(34)37-27(4,5)6)11-10-19(21)20(13-29)25(32)28(24,15-30)16-31/h8-10,12,17,21,24H,7,11,14,32H2,1-6H3 |
| InChIKey | RWXUTVGACDKSDP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|