C21H24N4O7S2 — CID 5235659
4-[bis(2-methoxyethyl)sulfamoyl]-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 5235659) has the molecular formula C21H24N4O7S2 and a molecular weight of 508.58 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)sulfamoyl]-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 5235659 |
| Molecular Formula | C21H24N4O7S2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc([N+](=O)[O-])ccc3n2C)cc1 |
| InChI | InChI=1S/C21H24N4O7S2/c1-23-18-9-6-16(25(27)28)14-19(18)33-21(23)22-20(26)15-4-7-17(8-5-15)34(29,30)24(10-12-31-2)11-13-32-3/h4-9,14H,10-13H2,1-3H3/b22-21- |
| InChIKey | NAXMWZJBFPWCRO-DQRAZIAOSA-N |
| XLogP | 2.17 |
| TPSA | 133.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|