C26H24BrNO4S — CID 5236452
5-[[2-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-butan-2-yl-1,3-thiazolidine-2,4-dione (PubChem CID 5236452) has the molecular formula C26H24BrNO4S and a molecular weight of 526.45 g/mol. Its IUPAC name is 5-[[2-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-butan-2-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-butan-2-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 5236452 |
| Molecular Formula | C26H24BrNO4S |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 525.06 |
| IUPAC Name | 5-[[2-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-butan-2-yl-1,3-thiazolidine-2,4-dione |
| SMILES | CCC(C)N1C(=O)SC(=Cc2cc(OC)c(OCc3cccc4ccccc34)cc2Br)C1=O |
| InChI | InChI=1S/C26H24BrNO4S/c1-4-16(2)28-25(29)24(33-26(28)30)13-19-12-22(31-3)23(14-21(19)27)32-15-18-10-7-9-17-8-5-6-11-20(17)18/h5-14,16H,4,15H2,1-3H3 |
| InChIKey | PVAGRFLERNCGKV-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|