C22H17BrN2S — CID 5236972
3-benzyl-4-(4-bromophenyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 5236972) has the molecular formula C22H17BrN2S and a molecular weight of 421.36 g/mol. Its IUPAC name is 3-benzyl-4-(4-bromophenyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-benzyl-4-(4-bromophenyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5236972 |
| Molecular Formula | C22H17BrN2S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 3-benzyl-4-(4-bromophenyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | Brc1ccc(-c2cs/c(=N\c3ccccc3)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H17BrN2S/c23-19-13-11-18(12-14-19)21-16-26-22(24-20-9-5-2-6-10-20)25(21)15-17-7-3-1-4-8-17/h1-14,16H,15H2/b24-22- |
| InChIKey | NOBABJIHIKGQQB-GYHWCHFESA-N |
| XLogP | 6.26 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|