About 1-bromo-2-methoxypropane
1-bromo-2-methoxypropane (PubChem CID 524021) has the molecular formula C4H9BrO
and a molecular weight of 153.02 g/mol. Its IUPAC name is 1-bromo-2-methoxypropane.
Molecular Properties
| Compound Name | 1-bromo-2-methoxypropane |
| PubChem CID | 524021 |
| Molecular Formula | C4H9BrO |
| Molecular Weight | 153.02 g/mol |
| Exact Mass | 151.98 |
| IUPAC Name | 1-bromo-2-methoxypropane |
| SMILES | COC(C)CBr |
| InChI | InChI=1S/C4H9BrO/c1-4(3-5)6-2/h4H,3H2,1-2H3 |
| InChIKey | ULHBRIULGNSYDP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.02 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methoxypropane?
The IUPAC name of 1-bromo-2-methoxypropane (CID 524021) is 1-bromo-2-methoxypropane.
What is the SMILES notation for 1-bromo-2-methoxypropane?
The canonical SMILES for 1-bromo-2-methoxypropane is COC(C)CBr.
What is the InChIKey of 1-bromo-2-methoxypropane?
The InChIKey is ULHBRIULGNSYDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9BrO/c1-4(3-5)6-2/h4H,3H2,1-2H3.
What are the key properties of 1-bromo-2-methoxypropane?
1-bromo-2-methoxypropane has a molecular weight of 153.02 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methoxypropane is sourced from PubChem (CID 524021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).