C10H10N4O3Se — CID 5240655
4-(4-nitro-2,1,3-benzoselenadiazol-5-yl)morpholine (PubChem CID 5240655) has the molecular formula C10H10N4O3Se and a molecular weight of 313.18 g/mol. Its IUPAC name is 4-(4-nitro-2,1,3-benzoselenadiazol-5-yl)morpholine.
| Compound Name | 4-(4-nitro-2,1,3-benzoselenadiazol-5-yl)morpholine |
|---|---|
| PubChem CID | 5240655 |
| Molecular Formula | C10H10N4O3Se |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 4-(4-nitro-2,1,3-benzoselenadiazol-5-yl)morpholine |
| SMILES | O=[N+]([O-])c1c(N2CCOCC2)ccc2n[se]nc12 |
| InChI | InChI=1S/C10H10N4O3Se/c15-14(16)10-8(13-3-5-17-6-4-13)2-1-7-9(10)12-18-11-7/h1-2H,3-6H2 |
| InChIKey | BCMLYKXCMYFAKS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|