C26H32N2O9S — CID 5244504
3-O-(2-ethylsulfanylethyl) 6-O-methyl 4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 5244504) has the molecular formula C26H32N2O9S and a molecular weight of 548.61 g/mol. Its IUPAC name is 3-O-(2-ethylsulfanylethyl) 6-O-methyl 4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-(2-ethylsulfanylethyl) 6-O-methyl 4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 5244504 |
| Molecular Formula | C26H32N2O9S |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 3-O-(2-ethylsulfanylethyl) 6-O-methyl 4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOc1cc(C2C(C(=O)OCCSCC)=C(C)NC3=C2C(=O)C(C(=O)OC)C(C)C3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C26H32N2O9S/c1-6-36-18-12-15(11-17(23(18)29)28(33)34)21-20(26(32)37-8-9-38-7-2)14(4)27-16-10-13(3)19(25(31)35-5)24(30)22(16)21/h11-13,19,21,27,29H,6-10H2,1-5H3 |
| InChIKey | UBFGCJJWQOWZEC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|