C21H22IN3O3 — CID 5244661
[2-(4-iodoanilino)-2-oxoethyl] 2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate (PubChem CID 5244661) has the molecular formula C21H22IN3O3 and a molecular weight of 491.33 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] 2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] 2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 5244661 |
| Molecular Formula | C21H22IN3O3 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] 2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
| SMILES | CCCn1c(C)cc(C=C(C#N)C(=O)OCC(=O)Nc2ccc(I)cc2)c1C |
| InChI | InChI=1S/C21H22IN3O3/c1-4-9-25-14(2)10-16(15(25)3)11-17(12-23)21(27)28-13-20(26)24-19-7-5-18(22)6-8-19/h5-8,10-11H,4,9,13H2,1-3H3,(H,24,26) |
| InChIKey | FFVKBCMYYNUFAO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|