About 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine
2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine (PubChem CID 5247902) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine.
Analyze 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine?
The IUPAC name of 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine (CID 5247902) is 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine.
What is the SMILES notation for 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine?
The canonical SMILES for 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine is CCc1nc(C2C=CC=CN2)n[nH]1.
What is the InChIKey of 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine?
The InChIKey is MFIXKPDEWGQFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-2-8-11-9(13-12-8)7-5-3-4-6-10-7/h3-7,10H,2H2,1H3,(H,11,12,13).
What are the key properties of 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine?
2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine has a molecular weight of 176.22 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-1H-1,2,4-triazol-3-yl)-1,2-dihydropyridine is sourced from PubChem (CID 5247902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).