About 2-(propoxymethoxy)butane
2-(propoxymethoxy)butane (PubChem CID 524897) has the molecular formula C8H18O2
and a molecular weight of 146.23 g/mol. Its IUPAC name is 2-(propoxymethoxy)butane.
Molecular Properties
| Compound Name | 2-(propoxymethoxy)butane |
| PubChem CID | 524897 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 2-(propoxymethoxy)butane |
| SMILES | CCCOCOC(C)CC |
| InChI | InChI=1S/C8H18O2/c1-4-6-9-7-10-8(3)5-2/h8H,4-7H2,1-3H3 |
| InChIKey | NPFCLWSPJBPJHY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(propoxymethoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propoxymethoxy)butane?
The IUPAC name of 2-(propoxymethoxy)butane (CID 524897) is 2-(propoxymethoxy)butane.
What is the SMILES notation for 2-(propoxymethoxy)butane?
The canonical SMILES for 2-(propoxymethoxy)butane is CCCOCOC(C)CC.
What is the InChIKey of 2-(propoxymethoxy)butane?
The InChIKey is NPFCLWSPJBPJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2/c1-4-6-9-7-10-8(3)5-2/h8H,4-7H2,1-3H3.
What are the key properties of 2-(propoxymethoxy)butane?
2-(propoxymethoxy)butane has a molecular weight of 146.23 g/mol, XLogP of 2.19, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propoxymethoxy)butane is sourced from PubChem (CID 524897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).