About methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate
methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate (PubChem CID 52502765) has the molecular formula C21H31N3O4
and a molecular weight of 389.50 g/mol. Its IUPAC name is methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate |
| PubChem CID | 52502765 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate |
| SMILES | COC(=O)CCN(CC(=O)NC(=O)N[C@@H]1CCCC[C@@H]1C)Cc1ccccc1 |
| InChI | InChI=1S/C21H31N3O4/c1-16-8-6-7-11-18(16)22-21(27)23-19(25)15-24(13-12-20(26)28-2)14-17-9-4-3-5-10-17/h3-5,9-10,16,18H,6-8,11-15H2,1-2H3,(H2,22,23,25,27)/t16-,18+/m0/s1 |
| InChIKey | YSIRDEKIMMCDGD-FUHWJXTLSA-N |
| XLogP | 2.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate?
The IUPAC name of methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate (CID 52502765) is methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate.
What is the SMILES notation for methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate?
The canonical SMILES for methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate is COC(=O)CCN(CC(=O)NC(=O)N[C@@H]1CCCC[C@@H]1C)Cc1ccccc1.
What is the InChIKey of methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate?
The InChIKey is YSIRDEKIMMCDGD-FUHWJXTLSA-N. The full InChI is InChI=1S/C21H31N3O4/c1-16-8-6-7-11-18(16)22-21(27)23-19(25)15-24(13-12-20(26)28-2)14-17-9-4-3-5-10-17/h3-5,9-10,16,18H,6-8,11-15H2,1-2H3,(H2,22,23,25,27)/t16-,18+/m0/s1.
What are the key properties of methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate?
methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate has a molecular weight of 389.50 g/mol, XLogP of 2.46, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[benzyl-[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl]amino]propanoate is sourced from PubChem (CID 52502765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).