C21H29N3O5 — CID 55426217
[2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 3-[(2-methylbenzoyl)amino]propanoate (PubChem CID 55426217) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 3-[(2-methylbenzoyl)amino]propanoate.
| Compound Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 3-[(2-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55426217 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 3-[(2-methylbenzoyl)amino]propanoate |
| SMILES | Cc1ccccc1C(=O)NCCC(=O)OCC(=O)NC(=O)NC1CCCCC1C |
| InChI | InChI=1S/C21H29N3O5/c1-14-7-3-5-9-16(14)20(27)22-12-11-19(26)29-13-18(25)24-21(28)23-17-10-6-4-8-15(17)2/h3,5,7,9,15,17H,4,6,8,10-13H2,1-2H3,(H,22,27)(H2,23,24,25,28) |
| InChIKey | ITQVHUUTTRNOEY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |