C21H29N5O3 — CID 52502885
N-[(2S)-3-methyl-2-(4-methylpiperidin-1-yl)butyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 52502885) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[(2S)-3-methyl-2-(4-methylpiperidin-1-yl)butyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | N-[(2S)-3-methyl-2-(4-methylpiperidin-1-yl)butyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 52502885 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-[(2S)-3-methyl-2-(4-methylpiperidin-1-yl)butyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | CC1CCN([C@H](CNC(=O)c2cnn(-c3ccc([N+](=O)[O-])cc3)c2)C(C)C)CC1 |
| InChI | InChI=1S/C21H29N5O3/c1-15(2)20(24-10-8-16(3)9-11-24)13-22-21(27)17-12-23-25(14-17)18-4-6-19(7-5-18)26(28)29/h4-7,12,14-16,20H,8-11,13H2,1-3H3,(H,22,27)/t20-/m1/s1 |
| InChIKey | ZRRAEIKPBUZCID-HXUWFJFHSA-N |
| XLogP | 3.27 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|