C20H25N3O3 — CID 52507586
(2R)-4-[3-(4-but-3-ynylpiperazin-1-yl)-3-oxopropyl]-2-methyl-1,4-benzoxazin-3-one (PubChem CID 52507586) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2R)-4-[3-(4-but-3-ynylpiperazin-1-yl)-3-oxopropyl]-2-methyl-1,4-benzoxazin-3-one.
| Compound Name | (2R)-4-[3-(4-but-3-ynylpiperazin-1-yl)-3-oxopropyl]-2-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 52507586 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (2R)-4-[3-(4-but-3-ynylpiperazin-1-yl)-3-oxopropyl]-2-methyl-1,4-benzoxazin-3-one |
| SMILES | C#CCCN1CCN(C(=O)CCN2C(=O)[C@@H](C)Oc3ccccc32)CC1 |
| InChI | InChI=1S/C20H25N3O3/c1-3-4-10-21-12-14-22(15-13-21)19(24)9-11-23-17-7-5-6-8-18(17)26-16(2)20(23)25/h1,5-8,16H,4,9-15H2,2H3/t16-/m1/s1 |
| InChIKey | STKUMDLMMHJZEV-MRXNPFEDSA-N |
| XLogP | 1.36 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|