C17H19FO3S — CID 52509826
1-[[(S)-3-(4-fluorophenoxy)propylsulfinyl]methyl]-3-methoxybenzene (PubChem CID 52509826) has the molecular formula C17H19FO3S and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-[[(S)-3-(4-fluorophenoxy)propylsulfinyl]methyl]-3-methoxybenzene.
| Compound Name | 1-[[(S)-3-(4-fluorophenoxy)propylsulfinyl]methyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 52509826 |
| Molecular Formula | C17H19FO3S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[[(S)-3-(4-fluorophenoxy)propylsulfinyl]methyl]-3-methoxybenzene |
| SMILES | COc1cccc(C[S@@](=O)CCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H19FO3S/c1-20-17-5-2-4-14(12-17)13-22(19)11-3-10-21-16-8-6-15(18)7-9-16/h2,4-9,12H,3,10-11,13H2,1H3/t22-/m0/s1 |
| InChIKey | XUPIPKABQKBSEJ-QFIPXVFZSA-N |
| XLogP | 3.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|