C19H22O4S — CID 123109781
3-[3-(4-ethylphenoxy)propylsulfinylmethyl]benzoic acid (PubChem CID 123109781) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is 3-[3-(4-ethylphenoxy)propylsulfinylmethyl]benzoic acid.
| Compound Name | 3-[3-(4-ethylphenoxy)propylsulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123109781 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-[3-(4-ethylphenoxy)propylsulfinylmethyl]benzoic acid |
| SMILES | CCc1ccc(OCCCS(=O)Cc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H22O4S/c1-2-15-7-9-18(10-8-15)23-11-4-12-24(22)14-16-5-3-6-17(13-16)19(20)21/h3,5-10,13H,2,4,11-12,14H2,1H3,(H,20,21) |
| InChIKey | CRAQHRBQQJVJIV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|