C21H21N3O3 — CID 52511313
2-(2,4-dioxopyrimidin-1-yl)-N-[(1R)-1,3-diphenylpropyl]acetamide (PubChem CID 52511313) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)-N-[(1R)-1,3-diphenylpropyl]acetamide.
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)-N-[(1R)-1,3-diphenylpropyl]acetamide |
|---|---|
| PubChem CID | 52511313 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)-N-[(1R)-1,3-diphenylpropyl]acetamide |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)N[C@H](CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O3/c25-19-13-14-24(21(27)23-19)15-20(26)22-18(17-9-5-2-6-10-17)12-11-16-7-3-1-4-8-16/h1-10,13-14,18H,11-12,15H2,(H,22,26)(H,23,25,27)/t18-/m1/s1 |
| InChIKey | OOBYMGPYYBQPIA-GOSISDBHSA-N |
| XLogP | 2.03 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |