C23H19N3O4 — CID 42927482
2-(2,4-dioxopyrimidin-1-yl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]acetamide (PubChem CID 42927482) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]acetamide.
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 42927482 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]acetamide |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)NC(c1ccccc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C23H19N3O4/c27-18-11-10-15-6-4-5-9-17(15)21(18)22(16-7-2-1-3-8-16)24-20(29)14-26-13-12-19(28)25-23(26)30/h1-13,22,27H,14H2,(H,24,29)(H,25,28,30) |
| InChIKey | BNESRQRJIMUXMW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|