C19H23N7O2 — CID 52511803
1-[(2R)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-[2-(tetrazol-1-yl)phenyl]urea (PubChem CID 52511803) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-[(2R)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-[2-(tetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[(2R)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-[2-(tetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 52511803 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-[(2R)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-[2-(tetrazol-1-yl)phenyl]urea |
| SMILES | COc1ccccc1[C@H](CNC(=O)Nc1ccccc1-n1cnnn1)N(C)C |
| InChI | InChI=1S/C19H23N7O2/c1-25(2)17(14-8-4-7-11-18(14)28-3)12-20-19(27)22-15-9-5-6-10-16(15)26-13-21-23-24-26/h4-11,13,17H,12H2,1-3H3,(H2,20,22,27)/t17-/m0/s1 |
| InChIKey | INYUMWSTVHRFBF-KRWDZBQOSA-N |
| XLogP | 2.10 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |