C21H24FN3O2 — CID 52513427
(2S)-N-cyclopropyl-2-[2-[[2-(3-fluorophenyl)acetyl]amino]ethylamino]-2-phenylacetamide (PubChem CID 52513427) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-[2-[[2-(3-fluorophenyl)acetyl]amino]ethylamino]-2-phenylacetamide.
| Compound Name | (2S)-N-cyclopropyl-2-[2-[[2-(3-fluorophenyl)acetyl]amino]ethylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 52513427 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2S)-N-cyclopropyl-2-[2-[[2-(3-fluorophenyl)acetyl]amino]ethylamino]-2-phenylacetamide |
| SMILES | O=C(Cc1cccc(F)c1)NCCN[C@H](C(=O)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C21H24FN3O2/c22-17-8-4-5-15(13-17)14-19(26)23-11-12-24-20(16-6-2-1-3-7-16)21(27)25-18-9-10-18/h1-8,13,18,20,24H,9-12,14H2,(H,23,26)(H,25,27)/t20-/m0/s1 |
| InChIKey | UBLRUUJBCZPDAB-FQEVSTJZSA-N |
| XLogP | 2.09 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|