C13H22N2O — CID 5251420
1-(1,2-dihydropyridin-6-yl)-1-piperidin-2-ylpropan-1-ol (PubChem CID 5251420) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(1,2-dihydropyridin-6-yl)-1-piperidin-2-ylpropan-1-ol.
| Compound Name | 1-(1,2-dihydropyridin-6-yl)-1-piperidin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 5251420 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(1,2-dihydropyridin-6-yl)-1-piperidin-2-ylpropan-1-ol |
| SMILES | CCC(O)(C1=CC=CCN1)C1CCCCN1 |
| InChI | InChI=1S/C13H22N2O/c1-2-13(16,11-7-3-5-9-14-11)12-8-4-6-10-15-12/h3,5,7,12,14-16H,2,4,6,8-10H2,1H3 |
| InChIKey | ALMPLRHTUSNPEJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |