C29H51N5O2 — CID 5232947
2,6-bis[methoxy-di(piperidin-2-yl)methyl]-1,2-dihydropyridine (PubChem CID 5232947) has the molecular formula C29H51N5O2 and a molecular weight of 501.76 g/mol. Its IUPAC name is 2,6-bis[methoxy-di(piperidin-2-yl)methyl]-1,2-dihydropyridine.
| Compound Name | 2,6-bis[methoxy-di(piperidin-2-yl)methyl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 5232947 |
| Molecular Formula | C29H51N5O2 |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.40 |
| IUPAC Name | 2,6-bis[methoxy-di(piperidin-2-yl)methyl]-1,2-dihydropyridine |
| SMILES | COC(C1=CC=CC(C(OC)(C2CCCCN2)C2CCCCN2)N1)(C1CCCCN1)C1CCCCN1 |
| InChI | InChI=1S/C29H51N5O2/c1-35-28(22-12-3-7-18-30-22,23-13-4-8-19-31-23)26-16-11-17-27(34-26)29(36-2,24-14-5-9-20-32-24)25-15-6-10-21-33-25/h11,16-17,22-26,30-34H,3-10,12-15,18-21H2,1-2H3 |
| InChIKey | NXPAAHSLJDOCNF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |