C24H28N2O2 — CID 52516146
4-[[ethyl(propan-2-yl)amino]methyl]-N-[(S)-furan-2-yl(phenyl)methyl]benzamide (PubChem CID 52516146) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-[[ethyl(propan-2-yl)amino]methyl]-N-[(S)-furan-2-yl(phenyl)methyl]benzamide.
| Compound Name | 4-[[ethyl(propan-2-yl)amino]methyl]-N-[(S)-furan-2-yl(phenyl)methyl]benzamide |
|---|---|
| PubChem CID | 52516146 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-[[ethyl(propan-2-yl)amino]methyl]-N-[(S)-furan-2-yl(phenyl)methyl]benzamide |
| SMILES | CCN(Cc1ccc(C(=O)N[C@@H](c2ccccc2)c2ccco2)cc1)C(C)C |
| InChI | InChI=1S/C24H28N2O2/c1-4-26(18(2)3)17-19-12-14-21(15-13-19)24(27)25-23(22-11-8-16-28-22)20-9-6-5-7-10-20/h5-16,18,23H,4,17H2,1-3H3,(H,25,27)/t23-/m0/s1 |
| InChIKey | DIWSNMHXHYKRJM-QHCPKHFHSA-N |
| XLogP | 5.03 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |