C20H28N2O3 — CID 111482555
4-[[ethyl(propan-2-yl)amino]methyl]-N-[2-(furan-2-yl)-2-hydroxypropyl]benzamide (PubChem CID 111482555) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-[[ethyl(propan-2-yl)amino]methyl]-N-[2-(furan-2-yl)-2-hydroxypropyl]benzamide.
| Compound Name | 4-[[ethyl(propan-2-yl)amino]methyl]-N-[2-(furan-2-yl)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 111482555 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 4-[[ethyl(propan-2-yl)amino]methyl]-N-[2-(furan-2-yl)-2-hydroxypropyl]benzamide |
| SMILES | CCN(Cc1ccc(C(=O)NCC(C)(O)c2ccco2)cc1)C(C)C |
| InChI | InChI=1S/C20H28N2O3/c1-5-22(15(2)3)13-16-8-10-17(11-9-16)19(23)21-14-20(4,24)18-7-6-12-25-18/h6-12,15,24H,5,13-14H2,1-4H3,(H,21,23) |
| InChIKey | PHCAWDKBCSYUIC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |