C38H70N2P2Si2 — CID 5251979
dicyclohexyl-[[3-[[dicyclohexyl(trimethylsilylimino)-lambda5-phosphanyl]methyl]phenyl]methyl]-trimethylsilylimino-lambda5-phosphane (PubChem CID 5251979) has the molecular formula C38H70N2P2Si2 and a molecular weight of 673.11 g/mol. Its IUPAC name is dicyclohexyl-[[3-[[dicyclohexyl(trimethylsilylimino)-lambda5-phosphanyl]methyl]phenyl]methyl]-trimethylsilylimino-lambda5-phosphane.
| Compound Name | dicyclohexyl-[[3-[[dicyclohexyl(trimethylsilylimino)-lambda5-phosphanyl]methyl]phenyl]methyl]-trimethylsilylimino-lambda5-phosphane |
|---|---|
| PubChem CID | 5251979 |
| Molecular Formula | C38H70N2P2Si2 |
| Molecular Weight | 673.11 g/mol |
| Exact Mass | 672.46 |
| IUPAC Name | dicyclohexyl-[[3-[[dicyclohexyl(trimethylsilylimino)-lambda5-phosphanyl]methyl]phenyl]methyl]-trimethylsilylimino-lambda5-phosphane |
| SMILES | C[Si](C)(C)N=P(Cc1cccc(CP(=N[Si](C)(C)C)(C2CCCCC2)C2CCCCC2)c1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C38H70N2P2Si2/c1-43(2,3)39-41(35-22-11-7-12-23-35,36-24-13-8-14-25-36)31-33-20-19-21-34(30-33)32-42(40-44(4,5)6,37-26-15-9-16-27-37)38-28-17-10-18-29-38/h19-21,30,35-38H,7-18,22-29,31-32H2,1-6H3 |
| InChIKey | MACYBZDJKFXJTB-UHFFFAOYSA-N |
| XLogP | 14.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.11 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|